CAS 113187-28-3
:allyl P,P-diethylphosphonoacetate
Description:
Allyl P,P-diethylphosphonoacetate is an organophosphorus compound characterized by its phosphonate functional group, which features a phosphorus atom bonded to two ethyl groups and an allyl group, along with an acetate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It possesses a relatively low molecular weight, which contributes to its potential use in various chemical applications, including as an intermediate in organic synthesis or as a potential agrochemical. The presence of the allyl group allows for further reactivity, making it a versatile building block in synthetic chemistry. Additionally, the phosphonate structure imparts certain biological activities, which may be of interest in the development of pharmaceuticals or pesticides. However, like many organophosphorus compounds, it may exhibit toxicity, necessitating careful handling and consideration of safety protocols during its use. Overall, allyl P,P-diethylphosphonoacetate is a compound of interest in both industrial and research settings due to its unique chemical properties.
Formula:C9H17O5P
InChI:InChI=1/C9H17O5P/c1-4-7-12-9(10)8-15(11,13-5-2)14-6-3/h4H,1,5-8H2,2-3H3
SMILES:C=CCOC(=O)CP(=O)(OCC)OCC
Synonyms:- Prop-2-En-1-Yl (Diethoxyphosphoryl)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Allyl P,P-diethylphosphonoacetate
CAS:Formula:C9H17O5PPurity:95%Color and Shape:LiquidMolecular weight:236.2020Ref: 10-F505620
1gTo inquire2gTo inquire5gTo inquire10gTo inquire25gTo inquire100mgTo inquire250mgTo inquire500mgTo inquireAllyl P,P-diethylphosphonoacetate
CAS:<p>Allyl P,P-diethylphosphonoacetate is a synthetic organic solvent that is soluble in water. It has an expressed form and an active methylene group. Allyl P,P-diethylphosphonoacetate is used in the synthesis of linear polymers through the addition of fluorine to the carbonyl group. The average particle diameter is 1 nm and it has a hydroxyl group.</p>Formula:C9H17O5PPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:236.2 g/mol


