CAS 1131992-26-1

6-Bromo-2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine

Description:

6-Bromo-2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo-pyrimidine framework. This compound features multiple halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of a phenylsulfonyl group enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic sulfonyl group, which can affect its solubility and permeability in biological systems. Additionally, the halogen atoms may contribute to its electronic properties, potentially impacting its binding affinity in drug design applications. Overall, this compound's unique structural features suggest potential utility in pharmaceutical research, particularly in the development of targeted therapies. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₂H₆BrCl₂N₃O₂S

InChI: InChI=1S/C12H6BrCl2N3O2S/c13-9-6-8-10(14)16-12(15)17-11(8)18(9)21(19,20)7-4-2-1-3-5-7/h1-6H

InChI key: InChIKey=MIFZKYAZWMEXLC-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(=C(Cl)N=C(Cl)N2)C=C1Br)C3=CC=CC=C3

Synonyms:

• 6-Bromo-2,4-dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine
• 7H-Pyrrolo[2,3-d]pyrimidine, 6-bromo-2,4-dichloro-7-(phenylsulfonyl)-