CAS 1132-14-5

3,5-DI-TERT-BUTYL-1H-PYRAZOLE

Description:

3,5-Di-tert-butyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of two tert-butyl groups at the 3 and 5 positions of the pyrazole ring significantly influences its physical and chemical properties. This compound is typically a white to off-white crystalline solid, exhibiting low solubility in water but higher solubility in organic solvents. It is known for its stability and resistance to oxidation, making it useful in various applications, including as a ligand in coordination chemistry and as an antioxidant in polymer formulations. Additionally, 3,5-di-tert-butyl-1H-pyrazole can act as a scavenger for free radicals, contributing to its potential use in protecting materials from degradation. Its CAS number, 1132-14-5, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks. Overall, this compound is valued for its unique structural features and functional properties in both research and industrial applications.

Formula: C₁₁H₂₀N₂

InChI: InChI=1/C11H20N2/c1-10(2,3)8-7-9(13-12-8)11(4,5)6/h7H,1-6H3,(H,12,13)

SMILES: CC(C)(C)c1cc(C(C)(C)C)n[nH]1

Synonyms:

• 1H-Pyrazole, 3,5-bis(1,1-dimethylethyl)-

1H-Pyrazole,3,5-bis(1,1-dimethylethyl)-

CAS: 1132-14-5

Formula: C₁₁H₂₀N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.2899

Ref: IN-DA0082BN

3,5-Di-tert-butyl-1h-pyrazole

CAS: 1132-14-5

3,5-Di-tert-butyl-1h-pyrazole

Purity: 97%

Ref: 54-OR1039259

3,5-Di-tert-butyl-1h-pyrazole

CAS: 1132-14-5

Purity: 97%

Molecular weight: 180.2949982

Ref: 10-F658030

3,5-Di-tert-butyl-1H-pyrazole

CAS: 1132-14-5

3,5-Di-tert-butyl-1H-pyrazole is a molecule that has two phenyl groups and one hydrogen bond. It is used as a reagent in analytical chemistry for the determination of hydrochloric acid and in crystallography for the study of x-ray crystal structures. 3,5-Di-tert-butyl-1H-pyrazole has been shown to have x-ray crystal structures with four nitrogens and one proton. The molecule also has a pyrazole ring at the center that contains one hydroxy group and two phenyl groups. The molecular weight of 3,5-Di-tert-butyl-1H-pyrazole is 152.2 g/mol.

Formula: C₁₁H₂₀N₂

Purity: Min. 95%

Molecular weight: 180.29 g/mol

Ref: 3D-BAA13214