CAS 1132-38-3
:N-Cyclohexylidenebenzenamine
Description:
N-Cyclohexylidenebenzenamine, also known as cyclohexylidene aniline, is an organic compound characterized by the presence of both a cyclohexyl group and an aniline moiety. It features a double bond between the nitrogen atom of the aniline and the carbon atom of the cyclohexyl group, which contributes to its reactivity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is relatively insoluble in water but soluble in organic solvents, making it useful in various chemical applications. N-Cyclohexylidenebenzenamine can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the presence of the amine functional group. Its applications may extend to the synthesis of dyes, pharmaceuticals, and other organic compounds. As with many amines, it may exhibit basic properties and can form salts with acids. Proper handling and safety precautions are essential, as it may pose health risks upon exposure.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-4,7-8H,2,5-6,9-10H2
InChI key:InChIKey=RPFGCUFAJAQNLJ-UHFFFAOYSA-N
SMILES:N(C1=CC=CC=C1)=C2CCCCC2
Synonyms:- Phenyliminocyclohexane
- Cyclohexanone anil
- Aniline, N-cyclohexylidene-
- N-Cyclohexylidenebenzenamine
- Benzenamine, N-cyclohexylidene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
