CAS 1132-42-9
:N-Cyclohexyl-3-oxobutanamide
Description:
N-Cyclohexyl-3-oxobutanamide, with the CAS number 1132-42-9, is an organic compound characterized by its amide functional group and a cyclohexyl substituent. This compound features a ketone group adjacent to the amide, contributing to its reactivity and potential applications in organic synthesis. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the cyclohexyl group imparts hydrophobic characteristics, influencing its solubility in various solvents. N-Cyclohexyl-3-oxobutanamide may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and pH. As with many organic compounds, safety precautions should be taken when handling N-Cyclohexyl-3-oxobutanamide, as it may pose health risks if ingested or inhaled.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9/h9H,2-7H2,1H3,(H,11,13)
InChI key:InChIKey=FLCPERRDPXWFDK-UHFFFAOYSA-N
SMILES:N(C(CC(C)=O)=O)C1CCCCC1
Synonyms:- Acetoacetamide, N-cyclohexyl-
- Butanamide, N-cyclohexyl-3-oxo-
- N-Acetoacetylcyclohexylamine
- N-cyclohexyl-3-oxobutanamide
- NSC 60220
- N-Cyclohexylacetoacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
