
CAS 113204-24-3
:3-Fluoro-N-4-pyridinylbenzamide
Description:
3-Fluoro-N-4-pyridinylbenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzamide moiety, which is an amide derived from benzoic acid, and a pyridine ring substituted at the 4-position with a fluorine atom at the 3-position of the benzamide. This compound exhibits properties typical of both aromatic amides and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity. The presence of the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering hydrogen bonding capabilities. 3-Fluoro-N-4-pyridinylbenzamide may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H9FN2O
InChI:InChI=1S/C12H9FN2O/c13-10-3-1-2-9(8-10)12(16)15-11-4-6-14-7-5-11/h1-8H,(H,14,15,16)
InChI key:InChIKey=CLTWXEOKGHKFQX-UHFFFAOYSA-N
SMILES:C(NC=1C=CN=CC1)(=O)C2=CC(F)=CC=C2
Synonyms:- Benzamide, 3-fluoro-N-4-pyridinyl-
- 3-Fluoro-N-4-pyridinylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.