CAS 113207-59-3

5'-aminospiro[1,3-dioxolane-2,3'-indol]-2'(1'H)-one

Description:

5'-Aminospiro[1,3-dioxolane-2,3'-indol]-2'(1'H)-one, with the CAS number 113207-59-3, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a dioxolane and an indole moiety. This compound features an amino group at the 5' position, contributing to its potential reactivity and biological activity. The presence of the dioxolane ring suggests that it may exhibit interesting properties related to ring strain and stereochemistry. Additionally, the indole structure is known for its significance in various biological systems, often serving as a building block in pharmaceuticals and natural products. The compound's potential applications may include roles in medicinal chemistry, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity would depend on the specific functional groups present and the overall molecular conformation. Further studies would be necessary to elucidate its full range of properties and potential uses in scientific and industrial applications.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1/C10H10N2O3/c11-6-1-2-8-7(5-6)10(9(13)12-8)14-3-4-15-10/h1-2,5H,3-4,11H2,(H,12,13)

SMILES: c1cc2c(cc1N)C1(C(=N2)O)OCCO1

Synonyms:

• 5'-aminospiro[1,3-dioxolane-2,3'-indol]-2'(1'H)-one(SALTDATA: FREE)
• 5-Aminospiro[indoline-3,2'-[1,3]dioxolan]-2-one
• Spiro[1,3-dioxolane-2,3'-[3H]indol]-2'(1'H)-one, 5'-amino-
• 5'-aminospiro[1，3-dioxolane-2，3'-indol]-2'(1'H)-one
• 5'-AMINOSPIRO[1,3-DIOXOLANE-2,3'-INDOL]-2'(1'H)-ONE