
CAS 113211-32-8
:2-[(Aminooxy)methyl]-5-(1-methylethyl)-1,3,4-oxadiazole
Description:
2-[(Aminooxy)methyl]-5-(1-methylethyl)-1,3,4-oxadiazole, with the CAS number 113211-32-8, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an aminooxy functional group, which is known for its reactivity and potential applications in bioconjugation and drug development. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The oxadiazole moiety is often associated with various biological activities, including antimicrobial and anticancer properties. Additionally, the compound's structure suggests potential for use in medicinal chemistry, particularly in the design of novel therapeutics. Its reactivity and functional groups may also allow for further derivatization, making it a versatile building block in organic synthesis. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of heterocycles in drug design.
Formula:C6H11N3O2
InChI:InChI=1S/C6H11N3O2/c1-4(2)6-9-8-5(11-6)3-10-7/h4H,3,7H2,1-2H3
InChI key:InChIKey=FCRLLQZOHKDZOE-UHFFFAOYSA-N
SMILES:C(C)(C)C=1OC(CON)=NN1
Synonyms:- 2-[(Aminooxy)methyl]-5-(1-methylethyl)-1,3,4-oxadiazole
- 1,3,4-Oxadiazole, 2-[(aminooxy)methyl]-5-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.