CAS 113211-53-3
:9'-fluoro-10'-(4-methyl-1-piperazinyl)-7'-oxospiro(cyclopropane-1,3'(2'H)-(7H)pyrido(1,2,3-de)(1,4)benzoxazine)-6'-carboxylic acid
Description:
9'-Fluoro-10'-(4-methyl-1-piperazinyl)-7'-oxospiro(cyclopropane-1,3'(2'H)-(7H)pyrido(1,2,3-de)(1,4)benzoxazine)-6'-carboxylic acid, with CAS number 113211-53-3, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates a cyclopropane moiety fused with a pyrido-benzoxazine framework. This compound features a fluorine atom and a piperazine substituent, contributing to its potential biological activity. The presence of a carboxylic acid functional group suggests that it may exhibit acidic properties, which can influence its solubility and reactivity in various environments. The intricate arrangement of heteroatoms and functional groups within its structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound exemplifies the diversity of chemical structures that can be synthesized for potential therapeutic applications, although detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C19H20FN3O4
InChI:InChI=1/C19H20FN3O4/c1-21-4-6-22(7-5-21)15-13(20)8-11-14-17(15)27-10-19(2-3-19)23(14)9-12(16(11)24)18(25)26/h8-9H,2-7,10H2,1H3,(H,25,26)
SMILES:CN1CCN(CC1)c1c(cc2c3c1OCC1(CC1)n3cc(c2=O)C(=O)O)F
Synonyms:- 9-Fpobc
- 9'-fluoro-10'-(4-methylpiperazin-1-yl)-7'-oxo-7'H-spiro[cyclopropane-1,3'-[1,4]oxazino[2,3,4-ij]quinoline]-6'-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Levofloxacin Impurity 38
CAS:Formula:C19H20FN3O4Color and Shape:Off-White SolidMolecular weight:373.38
