CymitQuimica logo

CAS 113212-14-9

:

METHYL 3-(DIMETHYLAMINO)-2-ISOCYANOACRYLATE

Description:
Methyl 3-(dimethylamino)-2-isocyanoacrylate, with the CAS number 113212-14-9, is a chemical compound characterized by its isocyanate functional group, which contributes to its reactivity and potential applications in polymer chemistry and materials science. This compound typically appears as a colorless to pale yellow liquid and is known for its ability to undergo polymerization, making it useful in the synthesis of various polymers and coatings. The presence of the dimethylamino group enhances its nucleophilicity, allowing it to participate in various chemical reactions, including those with electrophiles. Additionally, the methyl ester group contributes to its solubility in organic solvents, facilitating its use in formulations. Safety considerations are important when handling this compound, as isocyanates can be hazardous, requiring appropriate protective measures to prevent inhalation or skin contact. Overall, methyl 3-(dimethylamino)-2-isocyanoacrylate is a versatile compound with significant implications in the development of advanced materials.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-8-6(5-9(2)3)7(10)11-4/h5H,2-4H3/b6-5-
SMILES:[C-]#[N+]/C(=C\N(C)C)/C(=O)OC
Synonyms:
  • 3-Dimethylamino-2-Isocyanoacrylic Acid Methyl Ester
  • methyl (2E)-2-cyano-3-(dimethylamino)prop-2-enoate
  • methyl (2Z)-3-(dimethylamino)-2-isocyanoprop-2-enoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.