CAS 113237-19-7

Ethyl 5-fluoro-1,2-dihydro-6-hydroxy-2-oxo-3-pyridinecarboxylate

Description:

Ethyl 5-fluoro-1,2-dihydro-6-hydroxy-2-oxo-3-pyridinecarboxylate, identified by its CAS number 113237-19-7, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring with various functional groups, including a fluoro substituent and a carboxylate ester. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the keto group enhances its reactivity. The ethyl ester moiety suggests that it may exhibit moderate lipophilicity, which can influence its solubility and bioavailability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for biological activity, such as enzyme inhibition or receptor interaction. Additionally, the fluorine atom can enhance metabolic stability and influence the pharmacokinetic properties of the molecule. Overall, the unique combination of functional groups in Ethyl 5-fluoro-1,2-dihydro-6-hydroxy-2-oxo-3-pyridinecarboxylate makes it a compound of interest for further research and potential applications in drug development.

Formula: C₈H₈FNO₄

InChI: InChI=1S/C8H8FNO4/c1-2-14-8(13)4-3-5(9)7(12)10-6(4)11/h3H,2H2,1H3,(H2,10,11,12)

InChI key: InChIKey=AQZBIKIXQXSSFU-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=O)NC(O)=C(F)C1

Synonyms:

• Ethyl 5-fluoro-1,2-dihydro-6-hydroxy-2-oxo-3-pyridinecarboxylate
• Ethyl 2,6-dihydroxy-5-fluoronicotinate
• 3-Pyridinecarboxylic acid, 5-fluoro-1,2-dihydro-6-hydroxy-2-oxo-, ethyl ester