CAS 113247-37-3

Methyl 2-acetyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate

Description:

Methyl 2-acetyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, identified by its CAS number 113247-37-3, is a chemical compound belonging to the class of indole derivatives. This substance features a complex bicyclic structure that incorporates both pyridine and indole moieties, contributing to its unique chemical properties. It typically exhibits moderate solubility in organic solvents, which is common for many indole derivatives, while its solubility in water may be limited due to its hydrophobic characteristics. The presence of the methyl ester functional group suggests potential reactivity, particularly in esterification and hydrolysis reactions. Additionally, the acetyl group may impart specific biological activities, making this compound of interest in medicinal chemistry and pharmacology. Its structural features may also influence its interaction with biological targets, potentially leading to various pharmacological effects. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₅H₁₆N₂O₃

InChI: InChI=1S/C15H16N2O3/c1-9(18)17-8-13-11(7-14(17)15(19)20-2)10-5-3-4-6-12(10)16-13/h3-6,14,16H,7-8H2,1-2H3

InChI key: InChIKey=FXQZLCIYBPSROR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CC=2C=3C(NC2CN1C(C)=O)=CC=CC3

Synonyms:

• 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 2-acetyl-2,3,4,9-tetrahydro-, methyl ester
• 2-Acetyl-2,3,4,9-tetrahydro-1H-β-carboline-3-carboxylic acid methyl ester
• Methyl 2-acetyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate