CAS 113248-70-7
:2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)ethanamine
Description:
2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)ethanamine, with the CAS number 113248-70-7, is a chemical compound characterized by its unique structure, which includes a chlorophenyl group and a pyridinylmethyl moiety attached to an ethanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the chlorophenyl group may impart lipophilicity, influencing its solubility in organic solvents and biological membranes. The pyridine ring can contribute to the compound's potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific pharmacological activities, which can be explored through various assays. Its molecular structure suggests potential applications in drug development, particularly in areas related to neurochemistry or as a scaffold for synthesizing more complex molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H15ClN2
InChI:InChI=1/C14H15ClN2/c15-14-3-1-12(2-4-14)5-10-17-11-13-6-8-16-9-7-13/h1-4,6-9,17H,5,10-11H2
SMILES:c1cc(ccc1CCNCc1ccncc1)Cl
Synonyms:- 4-pyridinemethanamine, N-[2-(4-chlorophenyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.