
CAS 113248-80-9
:N-(2-Fluorophenyl)-3-pyridinemethanamine
Description:
N-(2-Fluorophenyl)-3-pyridinemethanamine, with the CAS number 113248-80-9, is an organic compound characterized by its unique structure, which includes a pyridine ring and a fluorophenyl group. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. The fluorine atom in the 2-position of the phenyl ring can influence the compound's reactivity and polarity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The presence of the pyridine moiety may contribute to its ability to participate in hydrogen bonding and coordination with metal ions. Additionally, this compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H11FN2
InChI:InChI=1S/C12H11FN2/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10/h1-8,15H,9H2
InChI key:InChIKey=YJXGFPILFSFXBI-UHFFFAOYSA-N
SMILES:N(CC=1C=CC=NC1)C2=C(F)C=CC=C2
Synonyms:- N-(2-Fluorophenyl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, N-(2-fluorophenyl)-
- (2-Fluoro-phenyl)-pyridin-3-ylmethyl-amine
- 2-Fluoro-N-[(pyridin-3-yl)methyl]aniline
- 2-Fluoro-N-(pyridin-3-ylmethyl)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.