CymitQuimica logo

CAS 1132610-44-6

:

1-(5-Fluoro-6-methyl-2-pyridinyl)-2-(6-quinoxalinyl)ethanone

Description:
1-(5-Fluoro-6-methyl-2-pyridinyl)-2-(6-quinoxalinyl)ethanone, identified by its CAS number 1132610-44-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine and a quinoxaline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the fluorine atom may enhance its pharmacological properties, such as lipophilicity and metabolic stability. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its synthesis involves multi-step organic reactions, often requiring careful control of reaction conditions to achieve the desired purity and yield. As with many heterocyclic compounds, it may exhibit unique reactivity patterns, making it a subject of interest for further research in drug development and material science. Overall, this compound represents a valuable addition to the library of chemical entities used in various scientific investigations.
Formula:C16H12FN3O
InChI:InChI=1S/C16H12FN3O/c1-10-12(17)3-5-14(20-10)16(21)9-11-2-4-13-15(8-11)19-7-6-18-13/h2-8H,9H2,1H3
InChI key:InChIKey=MNFNUEHQRUSBKJ-UHFFFAOYSA-N
SMILES:C(C(=O)C=1N=C(C)C(F)=CC1)C2=CC3=C(C=C2)N=CC=N3
Synonyms:
  • 1-(5-Fluoro-6-methyl-2-pyridinyl)-2-(6-quinoxalinyl)ethanone
  • Ethanone, 1-(5-fluoro-6-methyl-2-pyridinyl)-2-(6-quinoxalinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.