
CAS 1132610-47-9
:1-(5-Fluoro-6-methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-ylethanone
Description:
1-(5-Fluoro-6-methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-ylethanone is a chemical compound characterized by its complex structure, which includes a pyridine ring and a triazole moiety. The presence of a fluorine atom and a methyl group on the pyridine ring contributes to its unique electronic properties and potential biological activity. This compound is often studied for its pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit activity against various biological targets. The triazole ring enhances its stability and solubility, making it a candidate for drug development. Additionally, the compound's specific functional groups can influence its reactivity and interaction with other molecules. As with many synthetic organic compounds, understanding its characteristics, including solubility, melting point, and spectral properties, is crucial for its application in research and industry. Safety data and handling precautions should also be considered due to its potential biological effects.
Formula:C14H11FN4O
InChI:InChI=1S/C14H11FN4O/c1-9-11(15)3-4-12(18-9)13(20)6-10-2-5-14-16-8-17-19(14)7-10/h2-5,7-8H,6H2,1H3
InChI key:InChIKey=JYFYKETYUYEBDN-UHFFFAOYSA-N
SMILES:C(C(=O)C=1N=C(C)C(F)=CC1)C2=CN3C(C=C2)=NC=N3
Synonyms:- 1-(5-Fluoro-6-methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-ylethanone
- Ethanone, 1-(5-fluoro-6-methyl-2-pyridinyl)-2-[1,2,4]triazolo[1,5-a]pyridin-6-yl-
- 2-([1,2,4]Triazolo[1,5-a]pyridin-6-yl)-1-(5-fluoro-6-methylpyridin-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-([1,2,4]Triazolo[1,5-a]pyridin-6-yl)-1-(5-fluoro-6-methylpyridin-2-yl)ethanone
CAS:Formula:C14H11FN4OMolecular weight:270.2617
