CymitQuimica logo

CAS 1132639-46-3

:

Pentopyranose

Description:
Pentopyranose refers to a class of monosaccharides that contain a five-carbon sugar (pentose) in a pyranose form, which is a six-membered ring structure. The specific compound associated with the CAS number 1132639-46-3 is likely a derivative or specific isomer of pentopyranose. Generally, pentopyranoses exhibit characteristics typical of sugars, including solubility in water due to their hydroxyl (-OH) groups, which can form hydrogen bonds with water molecules. They are typically sweet-tasting and can participate in various biochemical reactions, including glycosylation and fermentation. Pentopyranoses can exist in equilibrium between their open-chain and cyclic forms, with the cyclic form being more stable in solution. These sugars play crucial roles in biological systems, serving as building blocks for nucleotides and nucleic acids, and are involved in energy metabolism. Their reactivity can vary based on the specific functional groups present, influencing their role in metabolic pathways and their potential applications in pharmaceuticals and biotechnology.
Formula:C5H10O5
InChI:InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2
InChI key:InChIKey=SRBFZHDQGSBBOR-UHFFFAOYSA-N
SMILES:OC1C(O)C(O)OCC1O
Synonyms:
  • Pentopyranose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.