CAS 113269-04-8

Benzenesulfonamide, N,N′-(4-chloro-5-nitro-1,2-phenylene)bis[4-methyl-

Description:

Benzenesulfonamide, N,N′-(4-chloro-5-nitro-1,2-phenylene)bis[4-methyl-] is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a bis-substituted phenyl structure, where the phenyl rings are connected through a sulfonamide linkage. The presence of a chloro and a nitro group on one of the phenyl rings contributes to its reactivity and potential biological activity. The methyl groups on the other phenyl ring enhance its lipophilicity, which can influence its solubility and interaction with biological membranes. This compound may be of interest in pharmaceutical research, particularly in the development of antimicrobial agents or other therapeutic applications. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. As with many sulfonamide derivatives, it may exhibit a range of biological activities, making it a subject of interest in medicinal chemistry.

Formula: C₂₀H₁₈ClN₃O₆S₂

InChI: InChI=1S/C20H18ClN3O6S2/c1-13-3-7-15(8-4-13)31(27,28)22-18-11-17(21)20(24(25)26)12-19(18)23-32(29,30)16-9-5-14(2)6-10-16/h3-12,22-23H,1-2H3

InChI key: InChIKey=VHELISWGWCTBCI-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=C(C)C=C1)C2=C(NS(=O)(=O)C3=CC=C(C)C=C3)C=C(Cl)C(N(=O)=O)=C2

Synonyms:

• Benzenesulfonamide, N,N′-(4-chloro-5-nitro-1,2-phenylene)bis[4-methyl-