CAS 113269-46-8
:oxetanocin G
Description:
Oxetanocin G is a nucleoside analog characterized by its unique oxetane ring structure, which contributes to its biological activity. It is derived from the purine nucleoside family and exhibits properties that make it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The compound is known for its ability to inhibit certain enzymes involved in nucleic acid synthesis, which can interfere with viral replication and tumor growth. Oxetanocin G is typically studied for its potential therapeutic applications, and its structure allows for interactions with various biological targets. Additionally, its solubility and stability under physiological conditions are important factors that influence its efficacy as a drug candidate. As with many nucleoside analogs, understanding its pharmacokinetics and toxicity profile is crucial for evaluating its potential in clinical settings. Overall, oxetanocin G represents a promising area of research in the development of new therapeutic agents.
Formula:C10H13N5O4
InChI:InChI=1/C10H13N5O4/c11-10-13-7-6(8(18)14-10)12-3-15(7)9-4(1-16)5(2-17)19-9/h3-5,9,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5-,9-/m1/s1
SMILES:C([C@@H]1[C@@H](CO)O[C@H]1n1cnc2c1[nH]c(=N)nc2O)O
Synonyms:- Oxt-G
- 6H-Purin-6-one, 2-amino-9-(3,4-bis(hydroxymethyl)-2-oxetanyl)-1,9-dihydro-, (2R-(2alpha,3beta,4alpha))-
- 2-amino-9-[(2R,3R,4S)-3,4-bis(hydroxymethyl)oxetan-2-yl]-3,9-dihydro-6H-purin-6-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
