CAS 113269-55-9
:5-bromo-2-sulfanylphenol
Description:
5-Bromo-2-sulfanylphenol, also known by its CAS number 113269-55-9, is an organic compound characterized by the presence of a bromine atom and a thiol (-SH) group attached to a phenolic structure. This compound features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and the substitution of a bromine atom at the 5-position and a sulfanyl group at the 2-position. The presence of the bromine atom imparts certain reactivity, making it useful in various chemical syntheses and applications. The thiol group contributes to its potential as a reducing agent and enhances its reactivity in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its solubility in organic solvents and moderate polarity are typical for such phenolic compounds, influencing its behavior in different chemical environments. Overall, 5-bromo-2-sulfanylphenol is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C6H5BrOS
InChI:InChI=1/C6H5BrOS/c7-4-1-2-6(9)5(8)3-4/h1-3,8-9H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.