CAS 1132701-00-8

1-[3-Bromo-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone

Description:

1-[3-Bromo-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone is a synthetic organic compound characterized by its complex structure, which includes a brominated phenyl group and a trifluoroethanone moiety. This compound features a bromine atom and three fluorine atoms, contributing to its unique reactivity and physical properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. The compound is likely to exhibit significant stability due to the strong C-F bonds, while the bromine atom can serve as a site for further chemical modifications. Its molecular structure suggests potential applications in the development of pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound's properties, such as solubility and volatility, would be influenced by the presence of multiple electronegative atoms, which can affect its interactions with other substances. Safety data and handling precautions should be considered due to the presence of halogens, which can pose environmental and health risks.

Formula: C₉H₃BrF₆O

InChI: InChI=1S/C9H3BrF6O/c10-6-2-4(7(17)9(14,15)16)1-5(3-6)8(11,12)13/h1-3H

InChI key: InChIKey=QRJHPNQWXZHJLT-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=CC(C(F)(F)F)=CC(Br)=C1

Synonyms:

• 3′-Bromo-2,2,2-trifluoro-5′-(trifluoromethyl)acetophenone
• Ethanone, 1-[3-bromo-5-(trifluoromethyl)phenyl]-2,2,2-trifluoro-
• 1-[3-Bromo-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone

3'-Bromo-2,2,2-trifluoro-5'-(trifluoromethyl)acetophenone

CAS: 1132701-00-8

3'-Bromo-2,2,2-trifluoro-5'-(trifluoromethyl)acetophenone

Purity: 95%

Color and Shape: Liquid

Molecular weight: 321.01g/mol

Ref: 54-PC49322