CAS 113274-80-9
:11-(4-(3-(trifluoromethyl)diazirinyl)phenyl)undecanoic acid
Description:
11-(4-(3-(Trifluoromethyl)diazirinyl)phenyl)undecanoic acid, with CAS number 113274-80-9, is a chemical compound characterized by its unique structure that includes a long hydrocarbon chain and a diazirine functional group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological interactions. The diazirine moiety is known for its ability to undergo photochemical reactions, making this compound useful in various applications, particularly in biochemistry and materials science for labeling and cross-linking studies. The undecanoic acid portion contributes to its amphiphilic nature, potentially allowing it to interact with both hydrophilic and hydrophobic environments. This compound may exhibit interesting properties such as stability under certain conditions, and its reactivity can be modulated by light exposure, making it a valuable tool in research settings. Overall, its unique combination of functional groups positions it as a versatile compound in synthetic and applied chemistry.
Formula:C19H25F3N2O2
InChI:InChI=1/C19H25F3N2O2/c20-19(21,22)18(23-24-18)16-13-11-15(12-14-16)9-7-5-3-1-2-4-6-8-10-17(25)26/h11-14H,1-10H2,(H,25,26)
SMILES:C(CCCCCC(=O)O)CCCCc1ccc(cc1)C1(C(F)(F)F)N=N1
Synonyms:- 11-Tdpu
- 11-{4-[3-(trifluoromethyl)-3H-diaziren-3-yl]phenyl}undecanoic acid
- 11-(4-(3-(Trifluoromethyl)diazirinyl)phenyl)undecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.