CymitQuimica logo

CAS 113283-35-5

:

6-Hydroxy-2-methyl-6-(4-methylphenyl)-2-hepten-4-one

Description:
6-Hydroxy-2-methyl-6-(4-methylphenyl)-2-hepten-4-one, with the CAS number 113283-35-5, is an organic compound characterized by its complex structure, which includes a ketone functional group and a hydroxyl group. This compound features a hepten backbone, indicating the presence of a double bond within a seven-carbon chain, and it is substituted with a 4-methylphenyl group, contributing to its aromatic characteristics. The presence of the hydroxyl group suggests that it may exhibit properties typical of alcohols, such as hydrogen bonding, which can influence its solubility and reactivity. Additionally, the methyl groups in the structure can affect its steric hindrance and overall stability. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed literature references for precise characterization.
Formula:C15H20O2
InChI:InChI=1S/C15H20O2/c1-11(2)9-14(16)10-15(4,17)13-7-5-12(3)6-8-13/h5-9,17H,10H2,1-4H3
InChI key:InChIKey=HFXMOIIGXSNZTK-UHFFFAOYSA-N
SMILES:C(CC(C=C(C)C)=O)(C)(O)C1=CC=C(C)C=C1
Synonyms:
  • 6-Hydroxy-2-methyl-6-(4-methylphenyl)-2-hepten-4-one
  • 2-Hepten-4-one, 6-hydroxy-2-methyl-6-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.