
CAS 1132832-76-8
:1-C-[3-[[5-(4-Fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-2,3,4,6-tetrakis-O-(trimethylsilyl)-α-D-glucopyranose
Description:
The chemical substance known as 1-C-[3-[[5-(4-Fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-2,3,4,6-tetrakis-O-(trimethylsilyl)-α-D-glucopyranose, with the CAS number 1132832-76-8, is a complex organic compound characterized by its structural features that include a glucopyranose backbone modified with multiple trimethylsilyl groups. The presence of a thienyl moiety and a fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their biological activity. The trimethylsilyl groups enhance the compound's solubility and stability, making it suitable for various analytical techniques, including chromatography. Additionally, the compound's intricate structure may exhibit unique reactivity patterns, which could be explored for synthetic applications or as a ligand in coordination chemistry. Overall, this substance represents a significant example of a glycosylated compound with potential implications in both research and industry, particularly in the fields of organic synthesis and drug development.
Formula:C36H57FO6SSi4
InChI:InChI=1S/C36H57FO6SSi4/c1-25-14-17-28(22-27(25)23-30-20-21-32(44-30)26-15-18-29(37)19-16-26)36(38)35(43-48(11,12)13)34(42-47(8,9)10)33(41-46(5,6)7)31(40-36)24-39-45(2,3)4/h14-22,31,33-35,38H,23-24H2,1-13H3/t31-,33-,34+,35-,36+/m1/s1
InChI key:InChIKey=YZFQLHRSWVLYNM-BOYYEFAASA-N
SMILES:O[C@@]1([C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O1)C2=CC(CC=3SC(=CC3)C4=CC=C(F)C=C4)=C(C)C=C2
Synonyms:- 1-C-[3-[[5-(4-Fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-2,3,4,6-tetrakis-O-(trimethylsilyl)-α-D-glucopyranose
- α-D-Glucopyranose, 1-C-[3-[[5-(4-fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-2,3,4,6-tetrakis-O-(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
TMS- Hydroxy Canagliflozin
CAS:Controlled ProductFormula:C36H57FO6SSi4Color and Shape:NeatMolecular weight:749.24

