CAS 1132935-63-7: Dasabuvir
Description:Dasabuvir is an antiviral medication primarily used in the treatment of hepatitis C virus (HCV) infections. It functions as a non-nucleoside polymerase inhibitor, specifically targeting the NS5B polymerase enzyme, which is crucial for viral replication. Dasabuvir is characterized by its ability to disrupt the viral life cycle, thereby reducing the viral load in infected individuals. The compound is typically administered in combination with other antiviral agents to enhance efficacy and prevent resistance. In terms of its chemical structure, Dasabuvir features a complex arrangement of functional groups that contribute to its pharmacological activity. It is generally well-tolerated, but like all medications, it may have side effects, which can vary among individuals. The drug is often part of a direct-acting antiviral regimen, reflecting the trend in modern antiviral therapies to utilize combinations of agents for improved treatment outcomes. Overall, Dasabuvir represents a significant advancement in the management of hepatitis C, contributing to higher cure rates and improved patient quality of life.
Formula:C26H27N3O5S
InChI:InChI=1S/C26H27N3O5S/c1-26(2,3)22-15-20(29-11-10-23(30)27-25(29)31)14-21(24(22)34-4)18-7-6-17-13-19(28-35(5,32)33)9-8-16(17)12-18/h6-15,28H,1-5H3,(H,27,30,31)
InChI key:InChIKey=NBRBXGKOEOGLOI-UHFFFAOYSA-N
SMILES:O=C1C=CN(C(=O)N1)C=2C=C(C3=CC=C4C=C(C=CC4=C3)NS(=O)(=O)C)C(OC)=C(C2)C(C)(C)C
- Synonyms:
- Dasabuvir
- Methanesulfonamide, N-[6-[5-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-3-(1,1-dimethylethyl)-2-methoxyphenyl]-2-naphthalenyl]-
- N-(6-(3-tert-butyl-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-2-methoxyphenyl)naphthalen-2-yl)methanesulfonamide
- N-[6-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]naphthalen-2-yl]methanesulfonamide
- N-[6-[5-(3,4-Dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-3-(1,1-dimethylethyl)-2-methoxyphenyl]-2-naphthalenyl]methanesulfonamide
- ABT 333
