CymitQuimica logo

CAS 1132943-97-5

:

Methyl 5-bromo-2,3-dihydro-1-methyl-1H-indene-1-carboxylate

Description:
Methyl 5-bromo-2,3-dihydro-1-methyl-1H-indene-1-carboxylate is a chemical compound characterized by its unique structure, which includes a bromine atom and a carboxylate ester functional group. This compound features a bicyclic indene framework, which contributes to its potential reactivity and applications in organic synthesis. The presence of the bromine substituent can enhance electrophilic reactivity, making it useful in various chemical transformations, such as nucleophilic substitutions or coupling reactions. The methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have different properties and reactivity. Additionally, the compound's dihydroindene structure suggests it may exhibit interesting physical properties, such as solubility in organic solvents. Its specific applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in synthetic organic chemistry. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and disposal.
Formula:C12H13BrO2
InChI:InChI=1S/C12H13BrO2/c1-12(11(14)15-2)6-5-8-7-9(13)3-4-10(8)12/h3-4,7H,5-6H2,1-2H3
InChI key:InChIKey=SERVUJOTRAMXJZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(C)C=2C(CC1)=CC(Br)=CC2
Synonyms:
  • 1H-Indene-1-carboxylic acid, 5-bromo-2,3-dihydro-1-methyl-, methyl ester
  • Methyl 5-bromo-2,3-dihydro-1-methyl-1H-indene-1-carboxylate
  • Methyl 5-bromo-1-methyl-2,3-dihydro-1H-indene-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.