CymitQuimica logo

CAS 1133-17-1

:

4-tert-butylbenzenesulfonic acid

Description:
4-tert-Butylbenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of a tert-butyl group attached to the para position of a benzene ring, with a sulfonic acid functional group (-SO3H) also attached to the benzene. This compound is typically a white to light yellow solid at room temperature and is soluble in polar solvents such as water and alcohols due to its sulfonic acid group. It exhibits strong acidity, making it useful as a catalyst and a reagent in various organic synthesis reactions. The presence of the bulky tert-butyl group enhances its steric properties, influencing its reactivity and solubility. 4-tert-Butylbenzenesulfonic acid is often employed in the synthesis of surfactants, dyes, and pharmaceuticals, as well as in polymer chemistry. Safety precautions should be taken when handling this compound, as it can be corrosive and may cause irritation to skin and eyes. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability.
Formula:C10H14O3S
InChI:InChI=1/C10H14O3S/c1-10(2,3)8-4-6-9(7-5-8)14(11,12)13/h4-7H,1-3H3,(H,11,12,13)
InChI key:LZQMCUIWYRQLOG-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cc1)S(=O)(=O)O
Found 5 products.