CAS 1133-77-3
:1-phenyl-1H-pyrazole-5-carboxylic acid
Description:
1-Phenyl-1H-pyrazole-5-carboxylic acid, with the CAS number 1133-77-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group attached to the pyrazole ring, enhancing its aromatic properties. The carboxylic acid functional group (-COOH) at the 5-position contributes to its acidity and reactivity, making it a versatile building block in organic synthesis. It is typically a white to off-white crystalline solid, and its solubility can vary depending on the solvent, often being more soluble in polar solvents due to the presence of the carboxylic acid group. 1-Phenyl-1H-pyrazole-5-carboxylic acid is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities and applications in drug development. Its reactivity allows for further derivatization, making it a valuable compound in synthetic organic chemistry.
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c13-10(14)9-6-7-11-12(9)8-4-2-1-3-5-8/h1-7H,(H,13,14)
SMILES:c1ccc(cc1)n1c(ccn1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrazole-5-carboxylicacid, 1-phenyl-
CAS:Formula:C10H8N2O2Purity:97%Color and Shape:SolidMolecular weight:188.18271-Phenyl-1H-pyrazole-5-carboxylic acid
CAS:1-Phenyl-1H-pyrazole-5-carboxylic acidFormula:C10H8N2O2Purity:97%Color and Shape: off-white to pale yellow powderMolecular weight:188.18g/mol1-Phenyl-1H-pyrazole-5-carboxylic acid
CAS:Formula:C10H8N2O2Purity:95%Color and Shape:SolidMolecular weight:188.1862-Phenyl-2H-pyrazole-3-carboxylic acid
CAS:2-Phenyl-2H-pyrazole-3-carboxylic acid is a heterocyclic compound that contains a pyrazole ring. It has shown anticoagulant activity and is being studied as an antidiabetic drug candidate. 2-Phenyl-2H-pyrazole-3-carboxylic acid can also be used in chemical reactions such as amide formation and amido formation. The compound also inhibits the conversion of vitamin B12 to its active form, which may contribute to its anticoagulant effects.Formula:C10H8N2O2Purity:Min. 95%Molecular weight:188.18 g/mol



