CAS 113305-56-9
:4-iodo-3-nitrophenol
Description:
4-Iodo-3-nitrophenol is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The presence of the iodine atom at the para position and the nitro group at the meta position relative to the hydroxyl group influences its reactivity and solubility in various solvents. This compound is typically a solid at room temperature and may exhibit yellowish coloration due to the nitro group. It is known for its applications in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Additionally, 4-iodo-3-nitrophenol can participate in electrophilic aromatic substitution reactions due to the activating effects of the nitro group and the deactivating effects of the iodine atom. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C6H4INO3
InChI:InChI=1/C6H4INO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H
SMILES:c1cc(c(cc1O)N(=O)=O)I
Synonyms:- Phenol, 4-Iodo-3-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodo-3-nitrophenol
CAS:4-Iodo-3-nitrophenolFormula:C6H4INO3Purity:97%Color and Shape: yellow solidMolecular weight:265.00533g/mol4-Iodo-3-nitrophenol
CAS:<p>4-Iodo-3-nitrophenol is a chemical compound that is used in the synthesis of decanoic acid, an ester. It also has pharmacological properties and can be used as a cataleptic or neuroleptic agent. 4-Iodo-3-nitrophenol has been shown to have stimulant effects on the central nervous system, which may be due to its ability to inhibit the metabolism of acetylcholine by blocking cholinesterase enzymes. 4-Iodo-3-nitrophenol is also used in the preparation of analogues and it has been tested for use as a treatment for Parkinson's disease.</p>Formula:C6H4INO3Purity:90%Color and Shape:Brown Yellow PowderMolecular weight:265.01 g/mol
