CAS 113305-94-5

2-AMINO-5-CYANOPYRAZINE

Description:

2-Amino-5-cyanopyrazine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyrazine ring, contributing to its reactivity and potential applications in various fields. The presence of the amino group makes it a potential candidate for further chemical modifications, while the cyano group can participate in nucleophilic reactions. 2-Amino-5-cyanopyrazine is typically a solid at room temperature and may exhibit solubility in polar solvents due to the functional groups present. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. This compound is of interest in medicinal chemistry and material science, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₆ClN₃

InChI: InChI=1/C8H6ClN3/c9-6-2-1-5-4-11-8(10)12-7(5)3-6/h1-4H,(H2,10,11,12)

SMILES: c1cc(cc2c1c[nH]c(=N)n2)Cl

Synonyms:

• Iflab-Bb F2108-0176
• 5-Aminopyrazine-2-Carbonitrile
• 5-Amino-5-Cyanopyrazine
• 5-Amino-2-Cyanopyrazine
• 5-Amino-pyrazine-2-carbonitrile

5-Aminopyrazine-2-carbonitrile

CAS: 113305-94-5

Formula: C₅H₄N₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 120.1121

Ref: IN-DA003GGW

5-Aminopyrazine-2-carbonitrile

CAS: 113305-94-5

5-Aminopyrazine-2-carbonitrile

Formula: C₅H₄N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 120.11205g/mol

Ref: 54-OR18000

5-Aminopyrazine-2-carbonitrile

CAS: 113305-94-5

Purity: 95%

Molecular weight: 120.112

Ref: FT-A11628

5-Amino-2-cyanopyrazine

CAS: 113305-94-5

Formula: C₅H₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 120.115

Ref: 10-F047827