CAS 1133115-36-2
:N-(3-Bromo-2-nitrophenyl)-4-methoxybenzenemethanamine
Description:
N-(3-Bromo-2-nitrophenyl)-4-methoxybenzenemethanamine is an organic compound characterized by its complex structure, which includes a methanamine group attached to a substituted phenyl ring. The presence of a bromine atom and a nitro group on one phenyl ring contributes to its reactivity and potential applications in various chemical reactions. The methoxy group on the para position of the second phenyl ring enhances its solubility in organic solvents and may influence its electronic properties. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the electron-withdrawing nitro group and the electron-donating methoxy group, which can affect its overall polarity and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogen and nitro functionalities, which can pose health risks.
Formula:C14H13BrN2O3
InChI:InChI=1S/C14H13BrN2O3/c1-20-11-7-5-10(6-8-11)9-16-13-4-2-3-12(15)14(13)17(18)19/h2-8,16H,9H2,1H3
InChI key:InChIKey=KAFGHCLAKBJYOB-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(OC)C=C1)C2=C(N(=O)=O)C(Br)=CC=C2
Synonyms:- N-(3-Bromo-2-nitrophenyl)-4-methoxybenzenemethanamine
- 3-Bromo-N-[(4-methoxyphenyl)methyl]-2-nitroaniline
- 3-Bromo-N-(4-methoxybenzyl)-2-nitroaniline
- Benzenemethanamine, N-(3-bromo-2-nitrophenyl)-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
