CAS 1133115-38-4
:2-Propen-1-yl 4-(4-bromophenyl)-1-piperazinecarboxylate
Description:
2-Propen-1-yl 4-(4-bromophenyl)-1-piperazinecarboxylate is a chemical compound characterized by its unique structure, which includes a piperazine ring, a bromophenyl group, and an acrylate moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the bromine atom in the phenyl group can enhance lipophilicity and influence the compound's interaction with biological targets. The piperazine ring is known for its role in pharmacology, often contributing to the modulation of neurotransmitter systems. As an ester, it may also undergo hydrolysis under certain conditions, leading to the release of the corresponding carboxylic acid and alcohol. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of agents targeting neurological or psychiatric disorders. However, specific safety and handling guidelines should be followed due to the presence of bromine, which can pose health risks.
Formula:C14H17BrN2O2
InChI:InChI=1S/C14H17BrN2O2/c1-2-11-19-14(18)17-9-7-16(8-10-17)13-5-3-12(15)4-6-13/h2-6H,1,7-11H2
InChI key:InChIKey=MTNKHWRTDGQBGE-UHFFFAOYSA-N
SMILES:C(OCC=C)(=O)N1CCN(CC1)C2=CC=C(Br)C=C2
Synonyms:- 1-Piperazinecarboxylic acid, 4-(4-bromophenyl)-, 2-propen-1-yl ester
- 2-Propen-1-yl 4-(4-bromophenyl)-1-piperazinecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Allyl 4-(4-bromophenyl)piperazine-1-carboxylate
CAS:Controlled ProductAllyl 4-(4-bromophenyl)piperazine-1-carboxylate is a novel organic compound, which can be prepared by the reaction of allyltrifluoromethanesulfonate with piperazine. It has been shown to have anti-cancer activity against a variety of cancer cells, such as human leukemia cells and human breast cancer cells. The chemical formula for this compound is C10H11BrO2. Allyl 4-(4-bromophenyl)piperazine-1-carboxylate is an imidazolium salt that can be used as an efficient method to lower blood glucose levels in diabetic patients. This compound also has anti-cancer properties and inhibits the growth of cancer cells.Formula:C14H17BrN2O2Purity:Min. 95%Molecular weight:325.2 g/mol

