CymitQuimica logo

CAS 1133115-48-6

:

Methyl 8-bromo-5-fluoro-4-hydroxy-2-quinolinecarboxylate

Description:
Methyl 8-bromo-5-fluoro-4-hydroxy-2-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features several functional groups, including a bromo group, a fluoro group, and a hydroxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. The compound's unique combination of halogen substituents and hydroxyl functionality may impart specific properties such as increased lipophilicity or altered solubility in various solvents. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity associated with quinoline derivatives. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity profile during handling and application.
Formula:C11H7BrFNO3
InChI:InChI=1S/C11H7BrFNO3/c1-17-11(16)7-4-8(15)9-6(13)3-2-5(12)10(9)14-7/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=VSCVZLBQUCUVBY-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(O)=CC(C(OC)=O)=N2)C(F)=CC1
Synonyms:
  • Methyl 8-bromo-5-fluoro-4-hydroxy-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 8-bromo-5-fluoro-4-hydroxy-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.