CAS 1133115-58-8
:Methyl 2-amino-4-(4-methylphenyl)-5-pyrimidinecarboxylate
Description:
Methyl 2-amino-4-(4-methylphenyl)-5-pyrimidinecarboxylate, identified by its CAS number 1133115-58-8, is a chemical compound characterized by its pyrimidine core structure, which is a six-membered ring containing nitrogen atoms. This compound features an amino group and a methylphenyl substituent, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylate group. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Methyl 2-amino-4-(4-methylphenyl)-5-pyrimidinecarboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other chemical species.
Formula:C13H13N3O2
InChI:InChI=1S/C13H13N3O2/c1-8-3-5-9(6-4-8)11-10(12(17)18-2)7-15-13(14)16-11/h3-7H,1-2H3,(H2,14,15,16)
InChI key:InChIKey=RURVMBMZJVLGHL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NC(N)=NC1)C2=CC=C(C)C=C2
Synonyms:- Methyl 2-amino-4-(4-methylphenyl)-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-amino-4-(4-methylphenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
