CAS 1133115-60-2
:Methyl 5-bromo-4-chloro-8-methyl-2-quinolinecarboxylate
Description:
Methyl 5-bromo-4-chloro-8-methyl-2-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features multiple halogen substituents, specifically bromine and chlorine, which can significantly influence its reactivity and biological activity. The presence of the methyl group enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. As a carboxylate ester, it may exhibit properties typical of esters, such as volatility and reactivity towards nucleophiles. This compound is of interest in medicinal chemistry and may be explored for its potential pharmacological properties, including antimicrobial or anticancer activities. Its unique combination of functional groups and structural features makes it a candidate for further research in drug development and synthetic applications. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C12H9BrClNO2
InChI:InChI=1S/C12H9BrClNO2/c1-6-3-4-7(13)10-8(14)5-9(12(16)17-2)15-11(6)10/h3-5H,1-2H3
InChI key:InChIKey=GDNKVLCQALRHCP-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(Cl)=CC(C(OC)=O)=N2)C(Br)=CC1
Synonyms:- 2-Quinolinecarboxylic acid, 5-bromo-4-chloro-8-methyl-, methyl ester
- Methyl 5-bromo-4-chloro-8-methyl-2-quinolinecarboxylate
- Methyl5-bromo-4-chloro-8-methylquinoline-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 5-bromo-4-chloro-8-methylquinoline-2-carboxylate
CAS:Formula:C12H9BrClNO2Molecular weight:314.5624
