CymitQuimica logo

CAS 1133115-62-4

:

Methyl 4-chloro-8-(trifluoromethyl)-2-quinolinecarboxylate

Description:
Methyl 4-chloro-8-(trifluoromethyl)-2-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a chloro group and a trifluoromethyl group enhances its electrophilic properties, making it potentially useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and altering biological activity. This compound may be of interest in medicinal chemistry and material science due to its structural features, which can influence biological interactions and physical properties. Additionally, its specific CAS number, 1133115-62-4, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases. Overall, this compound exemplifies the complexity and utility of halogenated quinoline derivatives in organic chemistry.
Formula:C12H7ClF3NO2
InChI:InChI=1S/C12H7ClF3NO2/c1-19-11(18)9-5-8(13)6-3-2-4-7(10(6)17-9)12(14,15)16/h2-5H,1H3
InChI key:InChIKey=PDSWVGRWFMQPLK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(C(Cl)=CC(C(OC)=O)=N2)C=CC1
Synonyms:
  • 2-Quinolinecarboxylic acid, 4-chloro-8-(trifluoromethyl)-, methyl ester
  • Methyl 4-chloro-8-(trifluoromethyl)-2-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.