CAS 1133115-64-6
:methyl4,7-dichloro-8-methylquinoline-2-carboxylate
Description:
Methyl 4,7-dichloro-8-methylquinoline-2-carboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features multiple chlorine substituents at the 4 and 7 positions and a methyl group at the 8 position, contributing to its unique chemical properties. The carboxylate functional group indicates that it is an ester, which typically enhances its solubility in organic solvents. The presence of chlorine atoms often imparts increased stability and can influence the compound's reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which is common among quinoline derivatives, potentially serving as a scaffold for drug development. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, affecting its physical properties such as melting point, boiling point, and solubility. Overall, methyl 4,7-dichloro-8-methylquinoline-2-carboxylate is a compound of interest in both synthetic chemistry and medicinal research.
Formula:C12H9Cl2NO2
InChI:InChI=1S/C12H9Cl2NO2/c1-6-8(13)4-3-7-9(14)5-10(12(16)17-2)15-11(6)7/h3-5H,1-2H3
InChI key:InChIKey=YCODGLFIKPZDTK-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(Cl)=CC(C(OC)=O)=N2)C=CC1Cl
Synonyms:- 2-Quinolinecarboxylic acid, 4,7-dichloro-8-methyl-, methyl ester
- Methyl 4,7-dichloro-8-methyl-2-quinolinecarboxylate
- Methyl4,7-dichloro-8-methylquinoline-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
