CAS 1133115-70-4
:Methyl 4-chloro-7,8-dimethyl-2-quinolinecarboxylate
Description:
Methyl 4-chloro-7,8-dimethyl-2-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of chlorine and multiple methyl groups on the quinoline ring influences its electronic properties and steric hindrance, potentially affecting its biological activity and interactions. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility in organic solvents, and reactivity with nucleophiles or electrophiles are important characteristics that can influence its utility in synthetic chemistry and research applications. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C13H12ClNO2
InChI:InChI=1S/C13H12ClNO2/c1-7-4-5-9-10(14)6-11(13(16)17-3)15-12(9)8(7)2/h4-6H,1-3H3
InChI key:InChIKey=VZYCKZKXAVZPOB-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(Cl)=CC(C(OC)=O)=N2)C=CC1C
Synonyms:- 2-Quinolinecarboxylic acid, 4-chloro-7,8-dimethyl-, methyl ester
- Methyl 4-chloro-7,8-dimethyl-2-quinolinecarboxylate
- Methyl4-chloro-7,8-dimethylquinoline-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
