CAS 1133115-76-0
:1-(5-Nitro-8-quinolinyl)-4-piperidinol
Description:
1-(5-Nitro-8-quinolinyl)-4-piperidinol is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a nitro group and a piperidinol functional group. This compound typically exhibits properties associated with both the quinoline and piperidine classes, including potential biological activity. The presence of the nitro group may enhance its reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. The piperidinol portion contributes to its solubility and interaction with biological targets. Additionally, compounds like this are often studied for their potential applications in drug development, particularly in areas such as antimicrobial or anticancer therapies. Its specific characteristics, such as melting point, solubility, and spectral properties, would be determined through experimental methods and may vary based on the conditions of synthesis and purification. Overall, 1-(5-Nitro-8-quinolinyl)-4-piperidinol represents a class of compounds that bridge organic chemistry and pharmacology, warranting further investigation for its potential therapeutic uses.
Formula:C14H15N3O3
InChI:InChI=1S/C14H15N3O3/c18-10-5-8-16(9-6-10)13-4-3-12(17(19)20)11-2-1-7-15-14(11)13/h1-4,7,10,18H,5-6,8-9H2
InChI key:InChIKey=ROLSKNAOHRRYNI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C(=CC1)N3CCC(O)CC3)N=CC=C2
Synonyms:- 1-(5-Nitro-8-quinolinyl)-4-piperidinol
- 4-Piperidinol, 1-(5-nitro-8-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
