CAS 1133115-78-2: 5-Bromo-8-fluoroquinoline
Description:5-Bromo-8-fluoroquinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by the presence of both bromine and fluorine substituents on the quinoline ring system. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of bromine and fluorine atoms introduces unique electronic and steric effects, influencing its chemical behavior and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. 5-Bromo-8-fluoroquinoline may exhibit biological activity, making it of interest in the study of antimicrobial and anticancer agents. Its solubility and reactivity can vary depending on the solvent and conditions, which is crucial for its application in synthetic pathways. Additionally, the compound's molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C9H5BrFN
InChI:InChI=1S/C9H5BrFN/c10-7-3-4-8(11)9-6(7)2-1-5-12-9/h1-5H
InChI key:InChIKey=KXPOUFUCFZQOQE-UHFFFAOYSA-N
SMILES:FC=1C=CC(Br)=C2C=CC=NC12
- Synonyms:
- 5-Bromo-8-Fluoroquinoline
- Quinoline, 5-bromo-8-fluoro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Bromo-8-fluoroquinoline REF: IN-DA0090G1CAS: 1133115-78-2 | 98% | 27.00 €~620.00 € | Tue 22 Apr 25 |
![]() | 5-Bromo-8-fluoroquinoline REF: 54-PC901861CAS: 1133115-78-2 | 98% | 43.00 €~640.00 € | Tue 29 Apr 25 |
![]() | 5-Bromo-8-fluoroquinoline REF: 10-F215900CAS: 1133115-78-2 | 95.0% | To inquire | Wed 30 Apr 25 |
![]() | 5-BroMo-8-fluoroquinoline REF: 3D-FB78129CAS: 1133115-78-2 | Min. 95% | - - - | Discontinued product |

5-Bromo-8-fluoroquinoline
Ref: IN-DA0090G1
1g | 57.00 € | ||
5g | 137.00 € | ||
10g | 190.00 € | ||
25g | 620.00 € | ||
100mg | 27.00 € | ||
250mg | 34.00 € |

5-Bromo-8-fluoroquinoline
Ref: 54-PC901861
1g | 96.00 € | ||
5g | 338.00 € | ||
250mg | 43.00 € |

5-Bromo-8-fluoroquinoline
Ref: 10-F215900
1g | 16.00 € | ||
5g | 72.00 € | ||
10g | 131.00 € | ||
25g | 300.00 € |

5-BroMo-8-fluoroquinoline
Ref: 3D-FB78129
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |