CAS 1133115-80-6
:2-(6-Bromo-2-naphthalenyl)-5-methyl-1,3,4-oxadiazole
Description:
2-(6-Bromo-2-naphthalenyl)-5-methyl-1,3,4-oxadiazole is a chemical compound characterized by its unique structure, which includes a naphthalene moiety substituted with a bromine atom and an oxadiazole ring. The presence of the oxadiazole group contributes to its potential as a heterocyclic compound, often associated with various biological activities and applications in materials science. This compound typically exhibits properties such as fluorescence, making it of interest in organic electronics and photonic applications. The bromine substitution can enhance its reactivity and solubility in organic solvents, which is beneficial for synthetic processes. Additionally, the methyl group at the 5-position of the oxadiazole ring can influence its electronic properties and stability. Overall, this compound's structural features suggest potential utility in fields such as medicinal chemistry, where derivatives of oxadiazoles are explored for their pharmacological properties, as well as in the development of advanced materials.
Formula:C13H9BrN2O
InChI:InChI=1S/C13H9BrN2O/c1-8-15-16-13(17-8)11-3-2-10-7-12(14)5-4-9(10)6-11/h2-7H,1H3
InChI key:InChIKey=AHEAYMGVAUKTMZ-UHFFFAOYSA-N
SMILES:CC=1OC(C2=CC3=C(C=C2)C=C(Br)C=C3)=NN1
Synonyms:- 1,3,4-Oxadiazole, 2-(6-bromo-2-naphthalenyl)-5-methyl-
- 2-(6-Bromo-2-naphthalenyl)-5-methyl-1,3,4-oxadiazole
- 2-(6-Bromonaphthalen-2-yl)-5-methyl-1,3,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
