CAS 1133115-85-1
:6-(Trifluoromethoxy)-5-quinolinamine
Description:
6-(Trifluoromethoxy)-5-quinolinamine is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a trifluoromethoxy group (-OCF3) at the 6-position enhances its lipophilicity and may influence its biological activity. The amino group (-NH2) at the 5-position contributes to its potential as a ligand in various chemical reactions and biological interactions. This compound is typically used in medicinal chemistry and may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on further studies. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the trifluoromethoxy group can enhance metabolic stability and alter the compound's pharmacokinetic properties. As with many fluorinated compounds, it may also exhibit unique solubility and reactivity characteristics, which can be advantageous in synthetic applications.
Formula:C10H7F3N2O
InChI:InChI=1S/C10H7F3N2O/c11-10(12,13)16-8-4-3-7-6(9(8)14)2-1-5-15-7/h1-5H,14H2
InChI key:InChIKey=LQSPPETUJPXBHI-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC1OC(F)(F)F)N=CC=C2
Synonyms:- 5-Quinolinamine, 6-(trifluoromethoxy)-
- 6-(Trifluoromethoxy)-5-quinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
