CymitQuimica logo

CAS 1133115-95-3

:

Methyl 6-(acetylamino)-4-chloro-2-quinolinecarboxylate

Description:
Methyl 6-(acetylamino)-4-chloro-2-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methyl ester functional group, an acetylamino group, and a chloro substituent, contributing to its unique chemical properties. The presence of the acetylamino group suggests potential for hydrogen bonding and reactivity, while the chloro group can influence the compound's electronic properties and reactivity in various chemical reactions. The methyl ester moiety indicates that the compound is likely to be soluble in organic solvents and may exhibit moderate polarity. This compound may be of interest in medicinal chemistry due to its structural features, which could impart biological activity. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, Methyl 6-(acetylamino)-4-chloro-2-quinolinecarboxylate represents a versatile compound with potential applications in pharmaceuticals or agrochemicals.
Formula:C13H11ClN2O3
InChI:InChI=1S/C13H11ClN2O3/c1-7(17)15-8-3-4-11-9(5-8)10(14)6-12(16-11)13(18)19-2/h3-6H,1-2H3,(H,15,17)
InChI key:InChIKey=MJEXZIPIXRWVPO-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(C(OC)=O)C1)C=CC(NC(C)=O)=C2
Synonyms:
  • Methyl 6-(acetylamino)-4-chloro-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 6-(acetylamino)-4-chloro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.