CymitQuimica logo

CAS 1133116-01-4

:

Methyl 8-bromo-6-chloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate

Description:
Methyl 8-bromo-6-chloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a quinoline moiety. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of bromine and chlorine substituents indicates potential for diverse chemical reactivity, including electrophilic substitution and nucleophilic attack. The dihydro-4-oxo structure suggests that it may exhibit tautomeric behavior, which can influence its biological activity and stability. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, as quinoline derivatives are known for various biological activities, including antimicrobial and anticancer effects. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity and reactivity associated with halogenated organic compounds.
Formula:C11H7BrClNO3
InChI:InChI=1S/C11H7BrClNO3/c1-17-11(16)8-4-9(15)6-2-5(13)3-7(12)10(6)14-8/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=WCWUTFMDWMNPAF-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(=O)C=C(C(OC)=O)N2)=CC(Cl)=C1
Synonyms:
  • Methyl 8-bromo-6-chloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 8-bromo-6-chloro-1,4-dihydro-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.