CymitQuimica logo

CAS 1133116-13-8

:

3-(4-Methylphenyl)-5-(3-thienyl)-1,2,4-oxadiazole

Description:
3-(4-Methylphenyl)-5-(3-thienyl)-1,2,4-oxadiazole is an organic compound characterized by its unique heterocyclic structure, which includes an oxadiazole ring fused with aromatic substituents. The presence of a 4-methylphenyl group and a 3-thienyl group contributes to its potential as a versatile building block in organic synthesis and materials science. This compound typically exhibits properties such as moderate solubility in organic solvents, which can facilitate its use in various applications, including organic electronics and photonic devices. Additionally, the oxadiazole moiety is known for its potential biological activity, making it a subject of interest in medicinal chemistry. The compound may also display interesting photophysical properties, such as fluorescence, which can be advantageous in sensor applications. Overall, 3-(4-Methylphenyl)-5-(3-thienyl)-1,2,4-oxadiazole represents a class of compounds that bridge the fields of organic chemistry and materials science, with implications for both research and practical applications.
Formula:C13H10N2OS
InChI:InChI=1S/C13H10N2OS/c1-9-2-4-10(5-3-9)12-14-13(16-15-12)11-6-7-17-8-11/h2-8H,1H3
InChI key:InChIKey=NYMJIHNAJCTRIZ-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=2N=C(ON2)C=3C=CSC3)C=C1
Synonyms:
  • 1,2,4-Oxadiazole, 3-(4-methylphenyl)-5-(3-thienyl)-
  • 3-(4-Methylphenyl)-5-(3-thienyl)-1,2,4-oxadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.