
CAS 1133116-21-8
:Methyl 5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate
Description:
Methyl 5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 5-position and a methyl group at the 8-position, contributing to its unique reactivity and potential biological activity. The presence of a carboxylate group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitutions. The compound's oxo group at the 4-position suggests it may exhibit keto-enol tautomerism, influencing its stability and reactivity. Methyl 5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its CAS number, 1133116-21-8, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the complexity and versatility of heterocyclic chemistry.
Formula:C12H10BrNO3
InChI:InChI=1S/C12H10BrNO3/c1-6-3-4-7(13)10-9(15)5-8(12(16)17-2)14-11(6)10/h3-5H,1-2H3,(H,14,15)
SMILES:Cc1ccc(c2c(=O)cc(C(=O)OC)[nH]c12)Br
Synonyms:- Methyl 5-bromo-8-methyl--4-hydroxyquinoline-2-carboxylate
- methyl-5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 5-bromo-8-methyl-4-oxo-1,4-dihydroquinoline-2-carboxylate
CAS:Formula:C12H10BrNO3Color and Shape:SolidMolecular weight:296.1167
