CAS 1133116-23-0
:Ethyl 1-[(4-methylphenyl)sulfonyl]-1H-imidazole-4-carboxylate
Description:
Ethyl 1-[(4-methylphenyl)sulfonyl]-1H-imidazole-4-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a sulfonyl group attached to a para-methylphenyl moiety, contributing to its potential as a pharmacological agent. The ethyl ester functional group enhances its solubility and reactivity, making it suitable for various chemical reactions. The presence of the carboxylate group indicates that it can participate in acid-base chemistry, while the sulfonyl group may influence its electronic properties and interactions with biological targets. This compound is of interest in medicinal chemistry due to its structural features, which may confer specific biological activities. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be evaluated for its potential applications in drug development or as a biochemical probe. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H14N2O4S
InChI:InChI=1S/C13H14N2O4S/c1-3-19-13(16)12-8-15(9-14-12)20(17,18)11-6-4-10(2)5-7-11/h4-9H,3H2,1-2H3
InChI key:InChIKey=JPZDAOZAKPSNLV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=C(C(OCC)=O)N=C1)C2=CC=C(C)C=C2
Synonyms:- 1H-Imidazole-4-carboxylic acid, 1-[(4-methylphenyl)sulfonyl]-, ethyl ester
- Ethyl 1-[(4-methylphenyl)sulfonyl]-1H-imidazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
