CAS 1133116-29-6
:1-[(3-Bromophenyl)sulfonyl]azetidine
Description:
1-[(3-Bromophenyl)sulfonyl]azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a sulfonyl group attached to the azetidine enhances its reactivity and solubility in various solvents. The 3-bromophenyl substituent introduces significant steric and electronic effects, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a subject of interest in medicinal chemistry. Additionally, the bromine atom can serve as a site for further chemical modifications, potentially leading to the development of new derivatives with enhanced activity. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the nature of the substituents. Overall, 1-[(3-Bromophenyl)sulfonyl]azetidine represents a versatile scaffold for further chemical exploration and potential applications in drug discovery.
Formula:C9H10BrNO2S
InChI:InChI=1S/C9H10BrNO2S/c10-8-3-1-4-9(7-8)14(12,13)11-5-2-6-11/h1,3-4,7H,2,5-6H2
InChI key:InChIKey=WHXRPYCUEZEQJG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(Br)=CC=C1)N2CCC2
Synonyms:- 1-[(3-Bromophenyl)sulfonyl]azetidine
- 1-(3-Bromobenzenesulfonyl)azetidine
- Azetidine, 1-[(3-bromophenyl)sulfonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(3-Bromo-benzenesulfonyl)-azetidine
CAS:1-(3-Bromo-benzenesulfonyl)-azetidine
Molecular weight:276.1502g/mol


