CymitQuimica logo

CAS 1133116-35-4

:

2-Bromo-1-methyl-4-[(trifluoromethyl)sulfonyl]benzene

Description:
2-Bromo-1-methyl-4-[(trifluoromethyl)sulfonyl]benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a trifluoromethylsulfonyl group attached to a methyl-substituted benzene ring. The presence of the bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions. The trifluoromethylsulfonyl group contributes to the compound's polarity and can influence its solubility in different solvents. This compound is likely to exhibit properties typical of sulfonyl-containing compounds, such as potential applications in pharmaceuticals or agrochemicals due to its ability to act as a versatile building block in synthetic chemistry. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's reactivity and stability. Overall, 2-Bromo-1-methyl-4-[(trifluoromethyl)sulfonyl]benzene is a complex molecule with potential utility in various chemical applications.
Formula:C8H6BrF3O2S
InChI:InChI=1S/C8H6BrF3O2S/c1-5-2-3-6(4-7(5)9)15(13,14)8(10,11)12/h2-4H,1H3
InChI key:InChIKey=PDRSFVRQMMJWTI-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)(=O)(=O)C1=CC(Br)=C(C)C=C1
Synonyms:
  • Benzene, 2-bromo-1-methyl-4-[(trifluoromethyl)sulfonyl]-
  • 2-Bromo-1-methyl-4-[(trifluoromethyl)sulfonyl]benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.