CAS 1133116-41-2
:6-Bromo-1-(tetrahydro-2H-pyran-2-yl)-2-naphthalenol
Description:
6-Bromo-1-(tetrahydro-2H-pyran-2-yl)-2-naphthalenol is an organic compound characterized by its complex structure, which includes a naphthalene moiety, a bromine substituent, and a tetrahydropyran ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. The tetrahydropyran group contributes to the compound's stereochemistry and can influence its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, which could facilitate interactions with biological targets. Additionally, the hydroxyl group in the naphthalene structure can participate in hydrogen bonding, affecting its physical properties such as melting point and solubility in polar solvents. Overall, 6-Bromo-1-(tetrahydro-2H-pyran-2-yl)-2-naphthalenol presents a unique combination of characteristics that may be explored in synthetic chemistry and medicinal applications.
Formula:C15H15BrO2
InChI:InChI=1S/C15H15BrO2/c16-11-5-6-12-10(9-11)4-7-13(17)15(12)14-3-1-2-8-18-14/h4-7,9,14,17H,1-3,8H2
InChI key:InChIKey=BLAOATBDNGAXIK-UHFFFAOYSA-N
SMILES:OC1=C(C2=C(C=C1)C=C(Br)C=C2)C3CCCCO3
Synonyms:- 2-Naphthalenol, 6-bromo-1-(tetrahydro-2H-pyran-2-yl)-
- 6-Bromo-1-(tetrahydro-2H-pyran-2-yl)-2-naphthalenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
